C31H29N3O6S — CID 11296072
5-amino-6-[4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]phenyl]-2-(1H-indol-3-ylmethyl)-4-oxohexanoic acid (PubChem CID 11296072) has the molecular formula C31H29N3O6S and a molecular weight of 571.66 g/mol. Its IUPAC name is 5-amino-6-[4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]phenyl]-2-(1H-indol-3-ylmethyl)-4-oxohexanoic acid.
| Compound Name | 5-amino-6-[4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]phenyl]-2-(1H-indol-3-ylmethyl)-4-oxohexanoic acid |
|---|---|
| PubChem CID | 11296072 |
| Molecular Formula | C31H29N3O6S |
| Molecular Weight | 571.66 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | 5-amino-6-[4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]phenyl]-2-(1H-indol-3-ylmethyl)-4-oxohexanoic acid |
| SMILES | NC(Cc1ccc(Oc2ccc(CC3SC(=O)NC3=O)cc2)cc1)C(=O)CC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C31H29N3O6S/c32-25(27(35)16-20(30(37)38)15-21-17-33-26-4-2-1-3-24(21)26)13-18-5-9-22(10-6-18)40-23-11-7-19(8-12-23)14-28-29(36)34-31(39)41-28/h1-12,17,20,25,28,33H,13-16,32H2,(H,37,38)(H,34,36,39) |
| InChIKey | CWVKSAZMLQWRGY-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 151.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.66 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|