C26H27N3O5 — CID 174890903
(2S)-2-amino-3-(1H-indol-3-yl)propanoic acid;phenyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate (PubChem CID 174890903) has the molecular formula C26H27N3O5 and a molecular weight of 461.52 g/mol. Its IUPAC name is (2S)-2-amino-3-(1H-indol-3-yl)propanoic acid;phenyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate.
| Compound Name | (2S)-2-amino-3-(1H-indol-3-yl)propanoic acid;phenyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 174890903 |
| Molecular Formula | C26H27N3O5 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | (2S)-2-amino-3-(1H-indol-3-yl)propanoic acid;phenyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate |
| SMILES | N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O.N[C@@H](Cc1ccc(O)cc1)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C15H15NO3.C11H12N2O2/c16-14(10-11-6-8-12(17)9-7-11)15(18)19-13-4-2-1-3-5-13;12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-9,14,17H,10,16H2;1-4,6,9,13H,5,12H2,(H,14,15)/t14-;9-/m00/s1 |
| InChIKey | WVTPINYWSZHLFO-FNADLCRPSA-N |
| XLogP | 2.99 |
| TPSA | 151.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|