C17H18Cl2N2O2 — CID 112974045
1-(2,3-dichlorophenyl)-3-[2-(3,5-dimethylphenoxy)ethyl]urea (PubChem CID 112974045) has the molecular formula C17H18Cl2N2O2 and a molecular weight of 353.25 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-3-[2-(3,5-dimethylphenoxy)ethyl]urea.
| Compound Name | 1-(2,3-dichlorophenyl)-3-[2-(3,5-dimethylphenoxy)ethyl]urea |
|---|---|
| PubChem CID | 112974045 |
| Molecular Formula | C17H18Cl2N2O2 |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-3-[2-(3,5-dimethylphenoxy)ethyl]urea |
| SMILES | Cc1cc(C)cc(OCCNC(=O)Nc2cccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C17H18Cl2N2O2/c1-11-8-12(2)10-13(9-11)23-7-6-20-17(22)21-15-5-3-4-14(18)16(15)19/h3-5,8-10H,6-7H2,1-2H3,(H2,20,21,22) |
| InChIKey | AGPXQRWNELSDKV-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|