C15H22N2O2 — CID 112974243
1-cyclopropyl-3-[2-(2,3,6-trimethylphenoxy)ethyl]urea (PubChem CID 112974243) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 1-cyclopropyl-3-[2-(2,3,6-trimethylphenoxy)ethyl]urea.
| Compound Name | 1-cyclopropyl-3-[2-(2,3,6-trimethylphenoxy)ethyl]urea |
|---|---|
| PubChem CID | 112974243 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 1-cyclopropyl-3-[2-(2,3,6-trimethylphenoxy)ethyl]urea |
| SMILES | Cc1ccc(C)c(OCCNC(=O)NC2CC2)c1C |
| InChI | InChI=1S/C15H22N2O2/c1-10-4-5-11(2)14(12(10)3)19-9-8-16-15(18)17-13-6-7-13/h4-5,13H,6-9H2,1-3H3,(H2,16,17,18) |
| InChIKey | AEZPFMZUEIJIAU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|