C16H26N2O2 — CID 112974246
1-(2-methylpropyl)-3-[2-(2,3,6-trimethylphenoxy)ethyl]urea (PubChem CID 112974246) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 1-(2-methylpropyl)-3-[2-(2,3,6-trimethylphenoxy)ethyl]urea.
| Compound Name | 1-(2-methylpropyl)-3-[2-(2,3,6-trimethylphenoxy)ethyl]urea |
|---|---|
| PubChem CID | 112974246 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 1-(2-methylpropyl)-3-[2-(2,3,6-trimethylphenoxy)ethyl]urea |
| SMILES | Cc1ccc(C)c(OCCNC(=O)NCC(C)C)c1C |
| InChI | InChI=1S/C16H26N2O2/c1-11(2)10-18-16(19)17-8-9-20-15-13(4)7-6-12(3)14(15)5/h6-7,11H,8-10H2,1-5H3,(H2,17,18,19) |
| InChIKey | MFGKZZOKFHNPOH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|