C19H25N3O3S — CID 112980886
N-[4-[2-(cyclohexen-1-yl)ethylamino]phenyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 112980886) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is N-[4-[2-(cyclohexen-1-yl)ethylamino]phenyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
| Compound Name | N-[4-[2-(cyclohexen-1-yl)ethylamino]phenyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 112980886 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-[4-[2-(cyclohexen-1-yl)ethylamino]phenyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)Nc1ccc(NCCC2=CCCCC2)cc1 |
| InChI | InChI=1S/C19H25N3O3S/c1-14-19(15(2)25-21-14)26(23,24)22-18-10-8-17(9-11-18)20-13-12-16-6-4-3-5-7-16/h6,8-11,20,22H,3-5,7,12-13H2,1-2H3 |
| InChIKey | ORHUJODIYGCVPB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|