C11H20O2 — CID 11298354
(2R)-2-[(2R,3S)-3-methyl-3-[(E)-pent-1-enyl]oxiran-2-yl]propan-1-ol (PubChem CID 11298354) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (2R)-2-[(2R,3S)-3-methyl-3-[(E)-pent-1-enyl]oxiran-2-yl]propan-1-ol.
| Compound Name | (2R)-2-[(2R,3S)-3-methyl-3-[(E)-pent-1-enyl]oxiran-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 11298354 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (2R)-2-[(2R,3S)-3-methyl-3-[(E)-pent-1-enyl]oxiran-2-yl]propan-1-ol |
| SMILES | CCC/C=C/[C@]1(C)O[C@@H]1[C@H](C)CO |
| InChI | InChI=1S/C11H20O2/c1-4-5-6-7-11(3)10(13-11)9(2)8-12/h6-7,9-10,12H,4-5,8H2,1-3H3/b7-6+/t9-,10-,11+/m1/s1 |
| InChIKey | HHSSIEMIRPCTIB-ZPYDHZESSA-N |
| XLogP | 2.13 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|