C20H15N3O — CID 11301448
4-cyano-N,N'-diphenylbenzohydrazide (PubChem CID 11301448) has the molecular formula C20H15N3O and a molecular weight of 313.36 g/mol. Its IUPAC name is 4-cyano-N,N'-diphenylbenzohydrazide.
| Compound Name | 4-cyano-N,N'-diphenylbenzohydrazide |
|---|---|
| PubChem CID | 11301448 |
| Molecular Formula | C20H15N3O |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 4-cyano-N,N'-diphenylbenzohydrazide |
| SMILES | N#Cc1ccc(C(=O)N(Nc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H15N3O/c21-15-16-11-13-17(14-12-16)20(24)23(19-9-5-2-6-10-19)22-18-7-3-1-4-8-18/h1-14,22H |
| InChIKey | ZRRORQACLSTORX-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|