C18H25N3O3S — CID 113015745
N-[6-(dipropylamino)-3-pyridinyl]-4-methoxybenzenesulfonamide (PubChem CID 113015745) has the molecular formula C18H25N3O3S and a molecular weight of 363.48 g/mol. Its IUPAC name is N-[6-(dipropylamino)-3-pyridinyl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[6-(dipropylamino)-3-pyridinyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 113015745 |
| Molecular Formula | C18H25N3O3S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | N-[6-(dipropylamino)-3-pyridinyl]-4-methoxybenzenesulfonamide |
| SMILES | CCCN(CCC)c1ccc(NS(=O)(=O)c2ccc(OC)cc2)cn1 |
| InChI | InChI=1S/C18H25N3O3S/c1-4-12-21(13-5-2)18-11-6-15(14-19-18)20-25(22,23)17-9-7-16(24-3)8-10-17/h6-11,14,20H,4-5,12-13H2,1-3H3 |
| InChIKey | MIIUAIAOEXLPDA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |