C16H23NO7 — CID 11302268
ethyl (1R,4S,5R,6R)-5-acetyloxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate (PubChem CID 11302268) has the molecular formula C16H23NO7 and a molecular weight of 341.36 g/mol. Its IUPAC name is ethyl (1R,4S,5R,6R)-5-acetyloxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate.
| Compound Name | ethyl (1R,4S,5R,6R)-5-acetyloxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate |
|---|---|
| PubChem CID | 11302268 |
| Molecular Formula | C16H23NO7 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | ethyl (1R,4S,5R,6R)-5-acetyloxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate |
| SMILES | CCOC(=O)C1=C[C@H]2O[C@H]2[C@H](OC(C)=O)[C@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H23NO7/c1-6-21-14(19)9-7-10-12(23-10)13(22-8(2)18)11(9)17-15(20)24-16(3,4)5/h7,10-13H,6H2,1-5H3,(H,17,20)/t10-,11+,12-,13-/m1/s1 |
| InChIKey | JDUJUTWHTRZSJE-YVECIDJPSA-N |
| XLogP | 1.08 |
| TPSA | 103.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|