C18H28N2O7 — CID 59146587
ethyl (3S,4S,5R)-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(prop-2-enoxycarbonylamino)cyclohexene-1-carboxylate (PubChem CID 59146587) has the molecular formula C18H28N2O7 and a molecular weight of 384.43 g/mol. Its IUPAC name is ethyl (3S,4S,5R)-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(prop-2-enoxycarbonylamino)cyclohexene-1-carboxylate.
| Compound Name | ethyl (3S,4S,5R)-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(prop-2-enoxycarbonylamino)cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 59146587 |
| Molecular Formula | C18H28N2O7 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | ethyl (3S,4S,5R)-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(prop-2-enoxycarbonylamino)cyclohexene-1-carboxylate |
| SMILES | C=CCOC(=O)N[C@@H]1CC(C(=O)OCC)=C[C@H](O)[C@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H28N2O7/c1-6-8-26-16(23)19-12-9-11(15(22)25-7-2)10-13(21)14(12)20-17(24)27-18(3,4)5/h6,10,12-14,21H,1,7-9H2,2-5H3,(H,19,23)(H,20,24)/t12-,13+,14+/m1/s1 |
| InChIKey | QDVOLLVNSZJZNI-RDBSUJKOSA-N |
| XLogP | 1.41 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|