2-hydroxy-6-[(3-phenoxybenzoyl)amino]benzoic acid

C20H15NO5 — CID 11302521

IUPAC2-hydroxy-6-[(3-phenoxybenzoyl)amino]benzoic acid
SMILESO=C(Nc1cccc(O)c1C(=O)O)c1cccc(Oc2ccccc2)c1
InChIInChI=1S/C20H15NO5/c22-17-11-5-10-16(18(17)20(24)25)21-19(23)13-6-4-9-15(12-13)26-14-7-2-1-3-8-14/h1-12,22H,(H,21,23)(H,24,25)
InChIKeyQXBHJJXXAXXUEZ-UHFFFAOYSA-N
MW349.34 g/mol
LogP4.14
Rot. Bonds5

About 2-hydroxy-6-[(3-phenoxybenzoyl)amino]benzoic acid

2-hydroxy-6-[(3-phenoxybenzoyl)amino]benzoic acid (PubChem CID 11302521) has the molecular formula C20H15NO5 and a molecular weight of 349.34 g/mol. Its IUPAC name is 2-hydroxy-6-[(3-phenoxybenzoyl)amino]benzoic acid.

Molecular Properties

Compound Name2-hydroxy-6-[(3-phenoxybenzoyl)amino]benzoic acid
PubChem CID11302521
Molecular FormulaC20H15NO5
Molecular Weight349.34 g/mol
Exact Mass349.10
IUPAC Name2-hydroxy-6-[(3-phenoxybenzoyl)amino]benzoic acid
SMILESO=C(Nc1cccc(O)c1C(=O)O)c1cccc(Oc2ccccc2)c1
InChIInChI=1S/C20H15NO5/c22-17-11-5-10-16(18(17)20(24)25)21-19(23)13-6-4-9-15(12-13)26-14-7-2-1-3-8-14/h1-12,22H,(H,21,23)(H,24,25)
InChIKeyQXBHJJXXAXXUEZ-UHFFFAOYSA-N
XLogP4.14
TPSA95.86 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms26
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500349.34
LogP ≤ 54.14
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 2-hydroxy-6-[(3-phenoxybenzoyl)amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

Acetaminosalol
CID 1984
2-[(3-Phenoxy-4-phenylbenzene)amido]benzoic acid
CID 11177309
(3-Phenoxybenzoylamino)benzoic acid deriv., 24l
CID 11166601
(3-Phenoxybenzoylamino)benzoic acid deriv., 24n
CID 11190026
(3-Phenoxybenzoylamino)benzoic acid deriv., 24j
CID 11201791
(3-Phenoxybenzoylamino)benzoic acid deriv., 24e
CID 11304773
(3-Phenoxybenzoylamino)benzoic acid deriv., 24h
CID 11316956
(3-Phenoxybenzoylamino)benzoic acid deriv., 24p
CID 11362807
(3-Phenoxybenzoylamino)benzoic acid deriv., 24k
CID 11375320
(3-Phenoxybenzoylamino)benzoic acid deriv., 33
CID 11384743
(3-Phenoxybenzoylamino)benzoic acid deriv., 24g
CID 11418865
(3-Phenoxybenzoylamino)benzoic acid deriv., 24d
CID 11454378

Frequently Asked Questions

What is the IUPAC name of 2-hydroxy-6-[(3-phenoxybenzoyl)amino]benzoic acid?
The IUPAC name of 2-hydroxy-6-[(3-phenoxybenzoyl)amino]benzoic acid (CID 11302521) is 2-hydroxy-6-[(3-phenoxybenzoyl)amino]benzoic acid.
What is the SMILES notation for 2-hydroxy-6-[(3-phenoxybenzoyl)amino]benzoic acid?
The canonical SMILES for 2-hydroxy-6-[(3-phenoxybenzoyl)amino]benzoic acid is O=C(Nc1cccc(O)c1C(=O)O)c1cccc(Oc2ccccc2)c1.
What is the InChIKey of 2-hydroxy-6-[(3-phenoxybenzoyl)amino]benzoic acid?
The InChIKey is QXBHJJXXAXXUEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15NO5/c22-17-11-5-10-16(18(17)20(24)25)21-19(23)13-6-4-9-15(12-13)26-14-7-2-1-3-8-14/h1-12,22H,(H,21,23)(H,24,25).
What are the key properties of 2-hydroxy-6-[(3-phenoxybenzoyl)amino]benzoic acid?
2-hydroxy-6-[(3-phenoxybenzoyl)amino]benzoic acid has a molecular weight of 349.34 g/mol, XLogP of 4.14, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-6-[(3-phenoxybenzoyl)amino]benzoic acid is sourced from PubChem (CID 11302521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).