C21H26N4O2 — CID 113039338
N-[6-[2-(cyclohexen-1-yl)ethylamino]pyridazin-3-yl]-3-phenoxypropanamide (PubChem CID 113039338) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is N-[6-[2-(cyclohexen-1-yl)ethylamino]pyridazin-3-yl]-3-phenoxypropanamide.
| Compound Name | N-[6-[2-(cyclohexen-1-yl)ethylamino]pyridazin-3-yl]-3-phenoxypropanamide |
|---|---|
| PubChem CID | 113039338 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | N-[6-[2-(cyclohexen-1-yl)ethylamino]pyridazin-3-yl]-3-phenoxypropanamide |
| SMILES | O=C(CCOc1ccccc1)Nc1ccc(NCCC2=CCCCC2)nn1 |
| InChI | InChI=1S/C21H26N4O2/c26-21(14-16-27-18-9-5-2-6-10-18)23-20-12-11-19(24-25-20)22-15-13-17-7-3-1-4-8-17/h2,5-7,9-12H,1,3-4,8,13-16H2,(H,22,24)(H,23,25,26) |
| InChIKey | HPBUVLXGFSNMAQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|