C17H22N4O2 — CID 113044277
N-[6-(tert-butylamino)pyridazin-3-yl]-3-phenoxypropanamide (PubChem CID 113044277) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is N-[6-(tert-butylamino)pyridazin-3-yl]-3-phenoxypropanamide.
| Compound Name | N-[6-(tert-butylamino)pyridazin-3-yl]-3-phenoxypropanamide |
|---|---|
| PubChem CID | 113044277 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | N-[6-(tert-butylamino)pyridazin-3-yl]-3-phenoxypropanamide |
| SMILES | CC(C)(C)Nc1ccc(NC(=O)CCOc2ccccc2)nn1 |
| InChI | InChI=1S/C17H22N4O2/c1-17(2,3)19-15-10-9-14(20-21-15)18-16(22)11-12-23-13-7-5-4-6-8-13/h4-10H,11-12H2,1-3H3,(H,19,21)(H,18,20,22) |
| InChIKey | VSNHSFPGYNOCJJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |