C18H22N4O3 — CID 113045169
N-[6-(dipropylamino)pyridazin-3-yl]-1,3-benzodioxole-5-carboxamide (PubChem CID 113045169) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-[6-(dipropylamino)pyridazin-3-yl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[6-(dipropylamino)pyridazin-3-yl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 113045169 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | N-[6-(dipropylamino)pyridazin-3-yl]-1,3-benzodioxole-5-carboxamide |
| SMILES | CCCN(CCC)c1ccc(NC(=O)c2ccc3c(c2)OCO3)nn1 |
| InChI | InChI=1S/C18H22N4O3/c1-3-9-22(10-4-2)17-8-7-16(20-21-17)19-18(23)13-5-6-14-15(11-13)25-12-24-14/h5-8,11H,3-4,9-10,12H2,1-2H3,(H,19,20,23) |
| InChIKey | MFRTVZPVJREFQA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |