C15H21N5O2S — CID 113046901
3-(dimethylsulfamoylamino)-6-(2-ethyl-6-methylanilino)pyridazine (PubChem CID 113046901) has the molecular formula C15H21N5O2S and a molecular weight of 335.43 g/mol. Its IUPAC name is 3-(dimethylsulfamoylamino)-6-(2-ethyl-6-methylanilino)pyridazine.
| Compound Name | 3-(dimethylsulfamoylamino)-6-(2-ethyl-6-methylanilino)pyridazine |
|---|---|
| PubChem CID | 113046901 |
| Molecular Formula | C15H21N5O2S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 3-(dimethylsulfamoylamino)-6-(2-ethyl-6-methylanilino)pyridazine |
| SMILES | CCc1cccc(C)c1Nc1ccc(NS(=O)(=O)N(C)C)nn1 |
| InChI | InChI=1S/C15H21N5O2S/c1-5-12-8-6-7-11(2)15(12)16-13-9-10-14(18-17-13)19-23(21,22)20(3)4/h6-10H,5H2,1-4H3,(H,16,17)(H,18,19) |
| InChIKey | IPHRRJWCJYABMP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |