C21H21FN4O3 — CID 113047289
3-(3,4-dimethoxyphenyl)-N-[6-(4-fluoroanilino)pyridazin-3-yl]propanamide (PubChem CID 113047289) has the molecular formula C21H21FN4O3 and a molecular weight of 396.42 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-[6-(4-fluoroanilino)pyridazin-3-yl]propanamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-[6-(4-fluoroanilino)pyridazin-3-yl]propanamide |
|---|---|
| PubChem CID | 113047289 |
| Molecular Formula | C21H21FN4O3 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-[6-(4-fluoroanilino)pyridazin-3-yl]propanamide |
| SMILES | COc1ccc(CCC(=O)Nc2ccc(Nc3ccc(F)cc3)nn2)cc1OC |
| InChI | InChI=1S/C21H21FN4O3/c1-28-17-9-3-14(13-18(17)29-2)4-12-21(27)24-20-11-10-19(25-26-20)23-16-7-5-15(22)6-8-16/h3,5-11,13H,4,12H2,1-2H3,(H,23,25)(H,24,26,27) |
| InChIKey | YYTCURNFGGMVER-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |