C13H13BrN4O2 — CID 113048068
methyl N-[6-(3-bromo-4-methylanilino)pyridazin-3-yl]carbamate (PubChem CID 113048068) has the molecular formula C13H13BrN4O2 and a molecular weight of 337.18 g/mol. Its IUPAC name is methyl N-[6-(3-bromo-4-methylanilino)pyridazin-3-yl]carbamate.
| Compound Name | methyl N-[6-(3-bromo-4-methylanilino)pyridazin-3-yl]carbamate |
|---|---|
| PubChem CID | 113048068 |
| Molecular Formula | C13H13BrN4O2 |
| Molecular Weight | 337.18 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | methyl N-[6-(3-bromo-4-methylanilino)pyridazin-3-yl]carbamate |
| SMILES | COC(=O)Nc1ccc(Nc2ccc(C)c(Br)c2)nn1 |
| InChI | InChI=1S/C13H13BrN4O2/c1-8-3-4-9(7-10(8)14)15-11-5-6-12(18-17-11)16-13(19)20-2/h3-7H,1-2H3,(H,15,17)(H,16,18,19) |
| InChIKey | SHYHJRXFRVNBJW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.18 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |