C12H10Cl2N4O2 — CID 113050861
methyl N-[6-(3,5-dichloroanilino)pyridazin-3-yl]carbamate (PubChem CID 113050861) has the molecular formula C12H10Cl2N4O2 and a molecular weight of 313.14 g/mol. Its IUPAC name is methyl N-[6-(3,5-dichloroanilino)pyridazin-3-yl]carbamate.
| Compound Name | methyl N-[6-(3,5-dichloroanilino)pyridazin-3-yl]carbamate |
|---|---|
| PubChem CID | 113050861 |
| Molecular Formula | C12H10Cl2N4O2 |
| Molecular Weight | 313.14 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | methyl N-[6-(3,5-dichloroanilino)pyridazin-3-yl]carbamate |
| SMILES | COC(=O)Nc1ccc(Nc2cc(Cl)cc(Cl)c2)nn1 |
| InChI | InChI=1S/C12H10Cl2N4O2/c1-20-12(19)16-11-3-2-10(17-18-11)15-9-5-7(13)4-8(14)6-9/h2-6H,1H3,(H,15,17)(H,16,18,19) |
| InChIKey | XQUOUFRSHNVHJY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.14 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |