methyl N-[6-(3,5-dichloroanilino)pyridazin-3-yl]carbamate

C12H10Cl2N4O2 — CID 113050861

IUPACmethyl N-[6-(3,5-dichloroanilino)pyridazin-3-yl]carbamate
SMILESCOC(=O)Nc1ccc(Nc2cc(Cl)cc(Cl)c2)nn1
InChIInChI=1S/C12H10Cl2N4O2/c1-20-12(19)16-11-3-2-10(17-18-11)15-9-5-7(13)4-8(14)6-9/h2-6H,1H3,(H,15,17)(H,16,18,19)
InChIKeyXQUOUFRSHNVHJY-UHFFFAOYSA-N
MW313.14 g/mol
LogP3.71
Rot. Bonds3

About methyl N-[6-(3,5-dichloroanilino)pyridazin-3-yl]carbamate

methyl N-[6-(3,5-dichloroanilino)pyridazin-3-yl]carbamate (PubChem CID 113050861) has the molecular formula C12H10Cl2N4O2 and a molecular weight of 313.14 g/mol. Its IUPAC name is methyl N-[6-(3,5-dichloroanilino)pyridazin-3-yl]carbamate.

Molecular Properties

Compound Namemethyl N-[6-(3,5-dichloroanilino)pyridazin-3-yl]carbamate
PubChem CID113050861
Molecular FormulaC12H10Cl2N4O2
Molecular Weight313.14 g/mol
Exact Mass312.02
IUPAC Namemethyl N-[6-(3,5-dichloroanilino)pyridazin-3-yl]carbamate
SMILESCOC(=O)Nc1ccc(Nc2cc(Cl)cc(Cl)c2)nn1
InChIInChI=1S/C12H10Cl2N4O2/c1-20-12(19)16-11-3-2-10(17-18-11)15-9-5-7(13)4-8(14)6-9/h2-6H,1H3,(H,15,17)(H,16,18,19)
InChIKeyXQUOUFRSHNVHJY-UHFFFAOYSA-N
XLogP3.71
TPSA76.14 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500313.14
LogP ≤ 53.71
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze methyl N-[6-(3,5-dichloroanilino)pyridazin-3-yl]carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl N-[6-(3,5-dichloroanilino)pyridazin-3-yl]carbamate?
The IUPAC name of methyl N-[6-(3,5-dichloroanilino)pyridazin-3-yl]carbamate (CID 113050861) is methyl N-[6-(3,5-dichloroanilino)pyridazin-3-yl]carbamate.
What is the SMILES notation for methyl N-[6-(3,5-dichloroanilino)pyridazin-3-yl]carbamate?
The canonical SMILES for methyl N-[6-(3,5-dichloroanilino)pyridazin-3-yl]carbamate is COC(=O)Nc1ccc(Nc2cc(Cl)cc(Cl)c2)nn1.
What is the InChIKey of methyl N-[6-(3,5-dichloroanilino)pyridazin-3-yl]carbamate?
The InChIKey is XQUOUFRSHNVHJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Cl2N4O2/c1-20-12(19)16-11-3-2-10(17-18-11)15-9-5-7(13)4-8(14)6-9/h2-6H,1H3,(H,15,17)(H,16,18,19).
What are the key properties of methyl N-[6-(3,5-dichloroanilino)pyridazin-3-yl]carbamate?
methyl N-[6-(3,5-dichloroanilino)pyridazin-3-yl]carbamate has a molecular weight of 313.14 g/mol, XLogP of 3.71, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[6-(3,5-dichloroanilino)pyridazin-3-yl]carbamate is sourced from PubChem (CID 113050861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).