C16H17BrN2O3 — CID 113053874
N-[2-[acetyl(furan-2-ylmethyl)amino]ethyl]-3-bromobenzamide (PubChem CID 113053874) has the molecular formula C16H17BrN2O3 and a molecular weight of 365.23 g/mol. Its IUPAC name is N-[2-[acetyl(furan-2-ylmethyl)amino]ethyl]-3-bromobenzamide.
| Compound Name | N-[2-[acetyl(furan-2-ylmethyl)amino]ethyl]-3-bromobenzamide |
|---|---|
| PubChem CID | 113053874 |
| Molecular Formula | C16H17BrN2O3 |
| Molecular Weight | 365.23 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | N-[2-[acetyl(furan-2-ylmethyl)amino]ethyl]-3-bromobenzamide |
| SMILES | CC(=O)N(CCNC(=O)c1cccc(Br)c1)Cc1ccco1 |
| InChI | InChI=1S/C16H17BrN2O3/c1-12(20)19(11-15-6-3-9-22-15)8-7-18-16(21)13-4-2-5-14(17)10-13/h2-6,9-10H,7-8,11H2,1H3,(H,18,21) |
| InChIKey | ZOOZVQWRZDDFTN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.23 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |