C22H30O8S — CID 11305571
[(3aR,5R,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] (1R)-1-phenylbut-3-ene-1-sulfonate (PubChem CID 11305571) has the molecular formula C22H30O8S and a molecular weight of 454.54 g/mol. Its IUPAC name is [(3aR,5R,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] (1R)-1-phenylbut-3-ene-1-sulfonate.
| Compound Name | [(3aR,5R,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] (1R)-1-phenylbut-3-ene-1-sulfonate |
|---|---|
| PubChem CID | 11305571 |
| Molecular Formula | C22H30O8S |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | [(3aR,5R,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] (1R)-1-phenylbut-3-ene-1-sulfonate |
| SMILES | C=CC[C@H](c1ccccc1)S(=O)(=O)O[C@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C22H30O8S/c1-6-10-16(14-11-8-7-9-12-14)31(23,24)30-18-17(15-13-25-21(2,3)27-15)26-20-19(18)28-22(4,5)29-20/h6-9,11-12,15-20H,1,10,13H2,2-5H3/t15-,16-,17-,18-,19-,20-/m1/s1 |
| InChIKey | LLPUYGUPLPAEQX-BZIXAJQCSA-N |
| XLogP | 3.05 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|