C19H19ClF2N2O2 — CID 113060172
N-[2-(N-acetyl-2-chloro-4,6-dimethylanilino)ethyl]-3,4-difluorobenzamide (PubChem CID 113060172) has the molecular formula C19H19ClF2N2O2 and a molecular weight of 380.82 g/mol. Its IUPAC name is N-[2-(N-acetyl-2-chloro-4,6-dimethylanilino)ethyl]-3,4-difluorobenzamide.
| Compound Name | N-[2-(N-acetyl-2-chloro-4,6-dimethylanilino)ethyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 113060172 |
| Molecular Formula | C19H19ClF2N2O2 |
| Molecular Weight | 380.82 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | N-[2-(N-acetyl-2-chloro-4,6-dimethylanilino)ethyl]-3,4-difluorobenzamide |
| SMILES | CC(=O)N(CCNC(=O)c1ccc(F)c(F)c1)c1c(C)cc(C)cc1Cl |
| InChI | InChI=1S/C19H19ClF2N2O2/c1-11-8-12(2)18(15(20)9-11)24(13(3)25)7-6-23-19(26)14-4-5-16(21)17(22)10-14/h4-5,8-10H,6-7H2,1-3H3,(H,23,26) |
| InChIKey | AMNFJEHJBQIZQT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.82 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |