C31H34N4O2 — CID 11306487
1-[4-(3-cyanophenyl)phenyl]-1-(1-cyclopentylpiperidin-4-yl)-3-(3-methoxyphenyl)urea (PubChem CID 11306487) has the molecular formula C31H34N4O2 and a molecular weight of 494.64 g/mol. Its IUPAC name is 1-[4-(3-cyanophenyl)phenyl]-1-(1-cyclopentylpiperidin-4-yl)-3-(3-methoxyphenyl)urea.
| Compound Name | 1-[4-(3-cyanophenyl)phenyl]-1-(1-cyclopentylpiperidin-4-yl)-3-(3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 11306487 |
| Molecular Formula | C31H34N4O2 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | 1-[4-(3-cyanophenyl)phenyl]-1-(1-cyclopentylpiperidin-4-yl)-3-(3-methoxyphenyl)urea |
| SMILES | COc1cccc(NC(=O)N(c2ccc(-c3cccc(C#N)c3)cc2)C2CCN(C3CCCC3)CC2)c1 |
| InChI | InChI=1S/C31H34N4O2/c1-37-30-11-5-8-26(21-30)33-31(36)35(29-16-18-34(19-17-29)27-9-2-3-10-27)28-14-12-24(13-15-28)25-7-4-6-23(20-25)22-32/h4-8,11-15,20-21,27,29H,2-3,9-10,16-19H2,1H3,(H,33,36) |
| InChIKey | RBIGRMCAQTZPPB-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |