C27H33N3 — CID 142154628
3-[4-[(1-cyclopentylpiperidin-4-yl)methyl-prop-1-en-2-ylamino]phenyl]benzonitrile (PubChem CID 142154628) has the molecular formula C27H33N3 and a molecular weight of 399.58 g/mol. Its IUPAC name is 3-[4-[(1-cyclopentylpiperidin-4-yl)methyl-prop-1-en-2-ylamino]phenyl]benzonitrile.
| Compound Name | 3-[4-[(1-cyclopentylpiperidin-4-yl)methyl-prop-1-en-2-ylamino]phenyl]benzonitrile |
|---|---|
| PubChem CID | 142154628 |
| Molecular Formula | C27H33N3 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.27 |
| IUPAC Name | 3-[4-[(1-cyclopentylpiperidin-4-yl)methyl-prop-1-en-2-ylamino]phenyl]benzonitrile |
| SMILES | C=C(C)N(CC1CCN(C2CCCC2)CC1)c1ccc(-c2cccc(C#N)c2)cc1 |
| InChI | InChI=1S/C27H33N3/c1-21(2)30(20-22-14-16-29(17-15-22)26-8-3-4-9-26)27-12-10-24(11-13-27)25-7-5-6-23(18-25)19-28/h5-7,10-13,18,22,26H,1,3-4,8-9,14-17,20H2,2H3 |
| InChIKey | LKUKGWDDAQADFY-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |