C14H14F2N2O4S — CID 113071817
N-[2-(2,4-difluoro-N-methylsulfonylanilino)ethyl]furan-2-carboxamide (PubChem CID 113071817) has the molecular formula C14H14F2N2O4S and a molecular weight of 344.34 g/mol. Its IUPAC name is N-[2-(2,4-difluoro-N-methylsulfonylanilino)ethyl]furan-2-carboxamide.
| Compound Name | N-[2-(2,4-difluoro-N-methylsulfonylanilino)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 113071817 |
| Molecular Formula | C14H14F2N2O4S |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | N-[2-(2,4-difluoro-N-methylsulfonylanilino)ethyl]furan-2-carboxamide |
| SMILES | CS(=O)(=O)N(CCNC(=O)c1ccco1)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H14F2N2O4S/c1-23(20,21)18(12-5-4-10(15)9-11(12)16)7-6-17-14(19)13-3-2-8-22-13/h2-5,8-9H,6-7H2,1H3,(H,17,19) |
| InChIKey | MIGZAUNJUJKEQK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |