C13H12F2N2O4S — CID 31820162
N-[2-[(2,5-difluorophenyl)sulfonylamino]ethyl]furan-2-carboxamide (PubChem CID 31820162) has the molecular formula C13H12F2N2O4S and a molecular weight of 330.31 g/mol. Its IUPAC name is N-[2-[(2,5-difluorophenyl)sulfonylamino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[(2,5-difluorophenyl)sulfonylamino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 31820162 |
| Molecular Formula | C13H12F2N2O4S |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | N-[2-[(2,5-difluorophenyl)sulfonylamino]ethyl]furan-2-carboxamide |
| SMILES | O=C(NCCNS(=O)(=O)c1cc(F)ccc1F)c1ccco1 |
| InChI | InChI=1S/C13H12F2N2O4S/c14-9-3-4-10(15)12(8-9)22(19,20)17-6-5-16-13(18)11-2-1-7-21-11/h1-4,7-8,17H,5-6H2,(H,16,18) |
| InChIKey | DQCDXSPPCRRCJX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|