C9H12N2O4S — CID 167799854
N-[2-(ethenylsulfonylamino)ethyl]furan-2-carboxamide (PubChem CID 167799854) has the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. Its IUPAC name is N-[2-(ethenylsulfonylamino)ethyl]furan-2-carboxamide.
| Compound Name | N-[2-(ethenylsulfonylamino)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 167799854 |
| Molecular Formula | C9H12N2O4S |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | N-[2-(ethenylsulfonylamino)ethyl]furan-2-carboxamide |
| SMILES | C=CS(=O)(=O)NCCNC(=O)c1ccco1 |
| InChI | InChI=1S/C9H12N2O4S/c1-2-16(13,14)11-6-5-10-9(12)8-4-3-7-15-8/h2-4,7,11H,1,5-6H2,(H,10,12) |
| InChIKey | QABKYGDSMVFXCM-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|