C15H18N2O6S2 — CID 55871013
N-[2-[(4-ethylsulfonylphenyl)sulfonylamino]ethyl]furan-2-carboxamide (PubChem CID 55871013) has the molecular formula C15H18N2O6S2 and a molecular weight of 386.45 g/mol. Its IUPAC name is N-[2-[(4-ethylsulfonylphenyl)sulfonylamino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[(4-ethylsulfonylphenyl)sulfonylamino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55871013 |
| Molecular Formula | C15H18N2O6S2 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | N-[2-[(4-ethylsulfonylphenyl)sulfonylamino]ethyl]furan-2-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc(S(=O)(=O)NCCNC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C15H18N2O6S2/c1-2-24(19,20)12-5-7-13(8-6-12)25(21,22)17-10-9-16-15(18)14-4-3-11-23-14/h3-8,11,17H,2,9-10H2,1H3,(H,16,18) |
| InChIKey | PWHNJGRJUXUYPP-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|