C31H34N2O7 — CID 11307317
4-(3-carboxypropyl)-8-[[4-(5-phenylpentoxy)benzoyl]amino]-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid (PubChem CID 11307317) has the molecular formula C31H34N2O7 and a molecular weight of 546.62 g/mol. Its IUPAC name is 4-(3-carboxypropyl)-8-[[4-(5-phenylpentoxy)benzoyl]amino]-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid.
| Compound Name | 4-(3-carboxypropyl)-8-[[4-(5-phenylpentoxy)benzoyl]amino]-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid |
|---|---|
| PubChem CID | 11307317 |
| Molecular Formula | C31H34N2O7 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | 4-(3-carboxypropyl)-8-[[4-(5-phenylpentoxy)benzoyl]amino]-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid |
| SMILES | O=C(O)CCCN1CC(C(=O)O)Oc2c(NC(=O)c3ccc(OCCCCCc4ccccc4)cc3)cccc21 |
| InChI | InChI=1S/C31H34N2O7/c34-28(35)14-8-19-33-21-27(31(37)38)40-29-25(12-7-13-26(29)33)32-30(36)23-15-17-24(18-16-23)39-20-6-2-5-11-22-9-3-1-4-10-22/h1,3-4,7,9-10,12-13,15-18,27H,2,5-6,8,11,14,19-21H2,(H,32,36)(H,34,35)(H,37,38) |
| InChIKey | BYTUMFJCBKNJKZ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|