C22H29N3O2 — CID 113078833
[4-[4-(diethylamino)phenyl]piperazin-1-yl]-(3-methoxyphenyl)methanone (PubChem CID 113078833) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is [4-[4-(diethylamino)phenyl]piperazin-1-yl]-(3-methoxyphenyl)methanone.
| Compound Name | [4-[4-(diethylamino)phenyl]piperazin-1-yl]-(3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 113078833 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | [4-[4-(diethylamino)phenyl]piperazin-1-yl]-(3-methoxyphenyl)methanone |
| SMILES | CCN(CC)c1ccc(N2CCN(C(=O)c3cccc(OC)c3)CC2)cc1 |
| InChI | InChI=1S/C22H29N3O2/c1-4-23(5-2)19-9-11-20(12-10-19)24-13-15-25(16-14-24)22(26)18-7-6-8-21(17-18)27-3/h6-12,17H,4-5,13-16H2,1-3H3 |
| InChIKey | SQXMMNSHEBXQDB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|