C21H26N2O2S — CID 5073983
[2-[4-(diethylamino)phenyl]-1,3-thiazolidin-3-yl]-(3-methoxyphenyl)methanone (PubChem CID 5073983) has the molecular formula C21H26N2O2S and a molecular weight of 370.52 g/mol. Its IUPAC name is [2-[4-(diethylamino)phenyl]-1,3-thiazolidin-3-yl]-(3-methoxyphenyl)methanone.
| Compound Name | [2-[4-(diethylamino)phenyl]-1,3-thiazolidin-3-yl]-(3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 5073983 |
| Molecular Formula | C21H26N2O2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | [2-[4-(diethylamino)phenyl]-1,3-thiazolidin-3-yl]-(3-methoxyphenyl)methanone |
| SMILES | CCN(CC)c1ccc(C2SCCN2C(=O)c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C21H26N2O2S/c1-4-22(5-2)18-11-9-16(10-12-18)21-23(13-14-26-21)20(24)17-7-6-8-19(15-17)25-3/h6-12,15,21H,4-5,13-14H2,1-3H3 |
| InChIKey | WOWZECNOCYJVNH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|