C18H16ClF3N2O — CID 113081149
2-(4-chlorophenyl)-1-[4-(2,3,4-trifluorophenyl)piperazin-1-yl]ethanone (PubChem CID 113081149) has the molecular formula C18H16ClF3N2O and a molecular weight of 368.79 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-[4-(2,3,4-trifluorophenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(4-chlorophenyl)-1-[4-(2,3,4-trifluorophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 113081149 |
| Molecular Formula | C18H16ClF3N2O |
| Molecular Weight | 368.79 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 2-(4-chlorophenyl)-1-[4-(2,3,4-trifluorophenyl)piperazin-1-yl]ethanone |
| SMILES | O=C(Cc1ccc(Cl)cc1)N1CCN(c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C18H16ClF3N2O/c19-13-3-1-12(2-4-13)11-16(25)24-9-7-23(8-10-24)15-6-5-14(20)17(21)18(15)22/h1-6H,7-11H2 |
| InChIKey | LTSKXWXRADEXGH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.79 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|