C20H24F2N2O2S — CID 113081441
1-(4-tert-butylphenyl)sulfonyl-4-(3,4-difluorophenyl)piperazine (PubChem CID 113081441) has the molecular formula C20H24F2N2O2S and a molecular weight of 394.49 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)sulfonyl-4-(3,4-difluorophenyl)piperazine.
| Compound Name | 1-(4-tert-butylphenyl)sulfonyl-4-(3,4-difluorophenyl)piperazine |
|---|---|
| PubChem CID | 113081441 |
| Molecular Formula | C20H24F2N2O2S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 1-(4-tert-butylphenyl)sulfonyl-4-(3,4-difluorophenyl)piperazine |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N2CCN(c3ccc(F)c(F)c3)CC2)cc1 |
| InChI | InChI=1S/C20H24F2N2O2S/c1-20(2,3)15-4-7-17(8-5-15)27(25,26)24-12-10-23(11-13-24)16-6-9-18(21)19(22)14-16/h4-9,14H,10-13H2,1-3H3 |
| InChIKey | CDAKJEYNJWKSEK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |