C17H11N3O4S2 — CID 113082962
N-[4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)phenyl]thiophene-2-sulfonamide (PubChem CID 113082962) has the molecular formula C17H11N3O4S2 and a molecular weight of 385.43 g/mol. Its IUPAC name is N-[4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113082962 |
| Molecular Formula | C17H11N3O4S2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | N-[4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)phenyl]thiophene-2-sulfonamide |
| SMILES | O=C1c2cccnc2C(=O)N1c1ccc(NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C17H11N3O4S2/c21-16-13-3-1-9-18-15(13)17(22)20(16)12-7-5-11(6-8-12)19-26(23,24)14-4-2-10-25-14/h1-10,19H |
| InChIKey | BUBCUEHWMXOSJJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|