C18H23ClN2O — CID 113085133
N-[[1-(5-chloro-1H-indol-3-yl)cyclopropyl]methyl]-2-ethylbutanamide (PubChem CID 113085133) has the molecular formula C18H23ClN2O and a molecular weight of 318.85 g/mol. Its IUPAC name is N-[[1-(5-chloro-1H-indol-3-yl)cyclopropyl]methyl]-2-ethylbutanamide.
| Compound Name | N-[[1-(5-chloro-1H-indol-3-yl)cyclopropyl]methyl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 113085133 |
| Molecular Formula | C18H23ClN2O |
| Molecular Weight | 318.85 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | N-[[1-(5-chloro-1H-indol-3-yl)cyclopropyl]methyl]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)NCC1(c2c[nH]c3ccc(Cl)cc23)CC1 |
| InChI | InChI=1S/C18H23ClN2O/c1-3-12(4-2)17(22)21-11-18(7-8-18)15-10-20-16-6-5-13(19)9-14(15)16/h5-6,9-10,12,20H,3-4,7-8,11H2,1-2H3,(H,21,22) |
| InChIKey | LKHCIHQOMFTBFA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.85 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |