C38H28Cl4N4 — CID 139229716
5-chloro-3-[1,4,4-tris(5-chloro-1H-indol-3-yl)cyclohexyl]-1H-indole (PubChem CID 139229716) has the molecular formula C38H28Cl4N4 and a molecular weight of 682.48 g/mol. Its IUPAC name is 5-chloro-3-[1,4,4-tris(5-chloro-1H-indol-3-yl)cyclohexyl]-1H-indole.
| Compound Name | 5-chloro-3-[1,4,4-tris(5-chloro-1H-indol-3-yl)cyclohexyl]-1H-indole |
|---|---|
| PubChem CID | 139229716 |
| Molecular Formula | C38H28Cl4N4 |
| Molecular Weight | 682.48 g/mol |
| Exact Mass | 680.11 |
| IUPAC Name | 5-chloro-3-[1,4,4-tris(5-chloro-1H-indol-3-yl)cyclohexyl]-1H-indole |
| SMILES | Clc1ccc2[nH]cc(C3(c4c[nH]c5ccc(Cl)cc45)CCC(c4c[nH]c5ccc(Cl)cc45)(c4c[nH]c5ccc(Cl)cc45)CC3)c2c1 |
| InChI | InChI=1S/C38H28Cl4N4/c39-21-1-5-33-25(13-21)29(17-43-33)37(30-18-44-34-6-2-22(40)14-26(30)34)9-11-38(12-10-37,31-19-45-35-7-3-23(41)15-27(31)35)32-20-46-36-8-4-24(42)16-28(32)36/h1-8,13-20,43-46H,9-12H2 |
| InChIKey | ZPRSEDVNPVWKFK-UHFFFAOYSA-N |
| XLogP | 12.07 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.48 |
| LogP ≤ 5 | 12.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |