C23H26N2O — CID 113086605
[4-[(2-methyl-1H-indol-3-yl)methyl]piperidin-1-yl]-(2-methylphenyl)methanone (PubChem CID 113086605) has the molecular formula C23H26N2O and a molecular weight of 346.47 g/mol. Its IUPAC name is [4-[(2-methyl-1H-indol-3-yl)methyl]piperidin-1-yl]-(2-methylphenyl)methanone.
| Compound Name | [4-[(2-methyl-1H-indol-3-yl)methyl]piperidin-1-yl]-(2-methylphenyl)methanone |
|---|---|
| PubChem CID | 113086605 |
| Molecular Formula | C23H26N2O |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | [4-[(2-methyl-1H-indol-3-yl)methyl]piperidin-1-yl]-(2-methylphenyl)methanone |
| SMILES | Cc1ccccc1C(=O)N1CCC(Cc2c(C)[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C23H26N2O/c1-16-7-3-4-8-19(16)23(26)25-13-11-18(12-14-25)15-21-17(2)24-22-10-6-5-9-20(21)22/h3-10,18,24H,11-15H2,1-2H3 |
| InChIKey | KBDNRKNTQLBMBJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|