C16H14ClFN2O4S — CID 1130970
methyl 2-[(2-chloroacetyl)amino]-5-[(4-fluorophenyl)carbamoyl]-4-methylthiophene-3-carboxylate (PubChem CID 1130970) has the molecular formula C16H14ClFN2O4S and a molecular weight of 384.82 g/mol. Its IUPAC name is methyl 2-[(2-chloroacetyl)amino]-5-[(4-fluorophenyl)carbamoyl]-4-methylthiophene-3-carboxylate.
| Compound Name | methyl 2-[(2-chloroacetyl)amino]-5-[(4-fluorophenyl)carbamoyl]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 1130970 |
| Molecular Formula | C16H14ClFN2O4S |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | methyl 2-[(2-chloroacetyl)amino]-5-[(4-fluorophenyl)carbamoyl]-4-methylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CCl)sc(C(=O)Nc2ccc(F)cc2)c1C |
| InChI | InChI=1S/C16H14ClFN2O4S/c1-8-12(16(23)24-2)15(20-11(21)7-17)25-13(8)14(22)19-10-5-3-9(18)4-6-10/h3-6H,7H2,1-2H3,(H,19,22)(H,20,21) |
| InChIKey | ZYWSSQWKFXMVIJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|