C21H22FN3O4 — CID 113097646
N-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-2-(2-methoxyphenyl)-2-oxoacetamide (PubChem CID 113097646) has the molecular formula C21H22FN3O4 and a molecular weight of 399.42 g/mol. Its IUPAC name is N-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-2-(2-methoxyphenyl)-2-oxoacetamide.
| Compound Name | N-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-2-(2-methoxyphenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 113097646 |
| Molecular Formula | C21H22FN3O4 |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | N-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-2-(2-methoxyphenyl)-2-oxoacetamide |
| SMILES | COc1ccccc1C(=O)C(=O)NCC(=O)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C21H22FN3O4/c1-29-18-9-5-2-6-15(18)20(27)21(28)23-14-19(26)25-12-10-24(11-13-25)17-8-4-3-7-16(17)22/h2-9H,10-14H2,1H3,(H,23,28) |
| InChIKey | AHMRCFGWCVVVIO-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|