C20H22FN3O3 — CID 113109072
4-(1,3-benzodioxol-5-yl)-N-[2-(2-fluorophenyl)ethyl]piperazine-1-carboxamide (PubChem CID 113109072) has the molecular formula C20H22FN3O3 and a molecular weight of 371.41 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-N-[2-(2-fluorophenyl)ethyl]piperazine-1-carboxamide.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-N-[2-(2-fluorophenyl)ethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113109072 |
| Molecular Formula | C20H22FN3O3 |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-N-[2-(2-fluorophenyl)ethyl]piperazine-1-carboxamide |
| SMILES | O=C(NCCc1ccccc1F)N1CCN(c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C20H22FN3O3/c21-17-4-2-1-3-15(17)7-8-22-20(25)24-11-9-23(10-12-24)16-5-6-18-19(13-16)27-14-26-18/h1-6,13H,7-12,14H2,(H,22,25) |
| InChIKey | JEIKDCSYBFIRCY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|