About [(3E,5E)-4-ethynyldeca-3,5-dienyl]benzene
[(3E,5E)-4-ethynyldeca-3,5-dienyl]benzene (PubChem CID 11310969) has the molecular formula C18H22
and a molecular weight of 238.37 g/mol. Its IUPAC name is [(3E,5E)-4-ethynyldeca-3,5-dienyl]benzene.
Molecular Properties
| Compound Name | [(3E,5E)-4-ethynyldeca-3,5-dienyl]benzene |
| PubChem CID | 11310969 |
| Molecular Formula | C18H22 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | [(3E,5E)-4-ethynyldeca-3,5-dienyl]benzene |
| SMILES | C#CC(/C=C/CCCC)=C/CCc1ccccc1 |
| InChI | InChI=1S/C18H22/c1-3-5-6-8-12-17(4-2)15-11-16-18-13-9-7-10-14-18/h2,7-10,12-15H,3,5-6,11,16H2,1H3/b12-8+,17-15- |
| InChIKey | HIDBOVMCOSMEKE-XJNJCNPFSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(3E,5E)-4-ethynyldeca-3,5-dienyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3E,5E)-4-ethynyldeca-3,5-dienyl]benzene?
The IUPAC name of [(3E,5E)-4-ethynyldeca-3,5-dienyl]benzene (CID 11310969) is [(3E,5E)-4-ethynyldeca-3,5-dienyl]benzene.
What is the SMILES notation for [(3E,5E)-4-ethynyldeca-3,5-dienyl]benzene?
The canonical SMILES for [(3E,5E)-4-ethynyldeca-3,5-dienyl]benzene is C#CC(/C=C/CCCC)=C/CCc1ccccc1.
What is the InChIKey of [(3E,5E)-4-ethynyldeca-3,5-dienyl]benzene?
The InChIKey is HIDBOVMCOSMEKE-XJNJCNPFSA-N. The full InChI is InChI=1S/C18H22/c1-3-5-6-8-12-17(4-2)15-11-16-18-13-9-7-10-14-18/h2,7-10,12-15H,3,5-6,11,16H2,1H3/b12-8+,17-15-.
What are the key properties of [(3E,5E)-4-ethynyldeca-3,5-dienyl]benzene?
[(3E,5E)-4-ethynyldeca-3,5-dienyl]benzene has a molecular weight of 238.37 g/mol, XLogP of 4.93, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(3E,5E)-4-ethynyldeca-3,5-dienyl]benzene is sourced from PubChem (CID 11310969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).