C13H20O4 — CID 11311005
(2S,6R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-[(E)-prop-1-enyl]oxan-4-one (PubChem CID 11311005) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is (2S,6R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-[(E)-prop-1-enyl]oxan-4-one.
| Compound Name | (2S,6R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-[(E)-prop-1-enyl]oxan-4-one |
|---|---|
| PubChem CID | 11311005 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | (2S,6R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-[(E)-prop-1-enyl]oxan-4-one |
| SMILES | C/C=C/[C@H]1CC(=O)C[C@@H]([C@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C13H20O4/c1-4-5-10-6-9(14)7-11(16-10)12-8-15-13(2,3)17-12/h4-5,10-12H,6-8H2,1-3H3/b5-4+/t10-,11-,12+/m0/s1 |
| InChIKey | FAQXBMJZYJIRAR-QCLDYOLQSA-N |
| XLogP | 1.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|