C14H22O4 — CID 11172832
(2R,3S,6R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methyl-2-[(E)-prop-1-enyl]oxan-4-one (PubChem CID 11172832) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is (2R,3S,6R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methyl-2-[(E)-prop-1-enyl]oxan-4-one.
| Compound Name | (2R,3S,6R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methyl-2-[(E)-prop-1-enyl]oxan-4-one |
|---|---|
| PubChem CID | 11172832 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | (2R,3S,6R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methyl-2-[(E)-prop-1-enyl]oxan-4-one |
| SMILES | C/C=C/[C@H]1O[C@@H]([C@H]2COC(C)(C)O2)CC(=O)[C@H]1C |
| InChI | InChI=1S/C14H22O4/c1-5-6-11-9(2)10(15)7-12(17-11)13-8-16-14(3,4)18-13/h5-6,9,11-13H,7-8H2,1-4H3/b6-5+/t9-,11-,12-,13-/m1/s1 |
| InChIKey | RGFLHMWXOJBWLX-WHACIMKNSA-N |
| XLogP | 2.08 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|