C28H46O6 — CID 10994435
[(E)-3-methyl-5-[(2S,6R)-3-methyl-4-oxo-6-[(4R,5S)-2,2,4-trimethyl-5-(3-methylbut-2-enyl)-1,3-dioxolan-4-yl]oxan-2-yl]pent-2-enyl] 2,2-dimethylpropanoate (PubChem CID 10994435) has the molecular formula C28H46O6 and a molecular weight of 478.67 g/mol. Its IUPAC name is [(E)-3-methyl-5-[(2S,6R)-3-methyl-4-oxo-6-[(4R,5S)-2,2,4-trimethyl-5-(3-methylbut-2-enyl)-1,3-dioxolan-4-yl]oxan-2-yl]pent-2-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(E)-3-methyl-5-[(2S,6R)-3-methyl-4-oxo-6-[(4R,5S)-2,2,4-trimethyl-5-(3-methylbut-2-enyl)-1,3-dioxolan-4-yl]oxan-2-yl]pent-2-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10994435 |
| Molecular Formula | C28H46O6 |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.33 |
| IUPAC Name | [(E)-3-methyl-5-[(2S,6R)-3-methyl-4-oxo-6-[(4R,5S)-2,2,4-trimethyl-5-(3-methylbut-2-enyl)-1,3-dioxolan-4-yl]oxan-2-yl]pent-2-enyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)=CC[C@@H]1OC(C)(C)O[C@]1(C)[C@H]1CC(=O)C(C)[C@H](CC/C(C)=C/COC(=O)C(C)(C)C)O1 |
| InChI | InChI=1S/C28H46O6/c1-18(2)11-14-23-28(10,34-27(8,9)33-23)24-17-21(29)20(4)22(32-24)13-12-19(3)15-16-31-25(30)26(5,6)7/h11,15,20,22-24H,12-14,16-17H2,1-10H3/b19-15+/t20?,22-,23-,24+,28-/m0/s1 |
| InChIKey | NQWROSWZZCRVSU-ISYMIXFGSA-N |
| XLogP | 5.93 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|