C15H24O4 — CID 11196446
(2S,3R,6S)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-ethyl-2-[(E)-prop-1-enyl]oxan-4-one (PubChem CID 11196446) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (2S,3R,6S)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-ethyl-2-[(E)-prop-1-enyl]oxan-4-one.
| Compound Name | (2S,3R,6S)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-ethyl-2-[(E)-prop-1-enyl]oxan-4-one |
|---|---|
| PubChem CID | 11196446 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (2S,3R,6S)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-ethyl-2-[(E)-prop-1-enyl]oxan-4-one |
| SMILES | C/C=C/[C@@H]1O[C@H]([C@H]2COC(C)(C)O2)CC(=O)[C@@H]1CC |
| InChI | InChI=1S/C15H24O4/c1-5-7-12-10(6-2)11(16)8-13(18-12)14-9-17-15(3,4)19-14/h5,7,10,12-14H,6,8-9H2,1-4H3/b7-5+/t10-,12-,13-,14+/m0/s1 |
| InChIKey | SNDVLVBIWKBHDJ-QGDUMRRRSA-N |
| XLogP | 2.47 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|