C13H22O5 — CID 11311460
(5R,7R,8R,9S,10S)-8-(methoxymethoxy)-9,10-dimethyl-1,6-dioxaspiro[4.5]decane-7-carbaldehyde (PubChem CID 11311460) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is (5R,7R,8R,9S,10S)-8-(methoxymethoxy)-9,10-dimethyl-1,6-dioxaspiro[4.5]decane-7-carbaldehyde.
| Compound Name | (5R,7R,8R,9S,10S)-8-(methoxymethoxy)-9,10-dimethyl-1,6-dioxaspiro[4.5]decane-7-carbaldehyde |
|---|---|
| PubChem CID | 11311460 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | (5R,7R,8R,9S,10S)-8-(methoxymethoxy)-9,10-dimethyl-1,6-dioxaspiro[4.5]decane-7-carbaldehyde |
| SMILES | COCO[C@@H]1[C@@H](C)[C@H](C)[C@@]2(CCCO2)O[C@H]1C=O |
| InChI | InChI=1S/C13H22O5/c1-9-10(2)13(5-4-6-17-13)18-11(7-14)12(9)16-8-15-3/h7,9-12H,4-6,8H2,1-3H3/t9-,10-,11-,12+,13+/m0/s1 |
| InChIKey | XQPYHZTUFSEXTE-JZRPKSSGSA-N |
| XLogP | 1.35 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|