C20H30N2O3 — CID 113117359
3-[acetyl(oxolan-2-ylmethyl)amino]-N-(2-tert-butylphenyl)propanamide (PubChem CID 113117359) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is 3-[acetyl(oxolan-2-ylmethyl)amino]-N-(2-tert-butylphenyl)propanamide.
| Compound Name | 3-[acetyl(oxolan-2-ylmethyl)amino]-N-(2-tert-butylphenyl)propanamide |
|---|---|
| PubChem CID | 113117359 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 3-[acetyl(oxolan-2-ylmethyl)amino]-N-(2-tert-butylphenyl)propanamide |
| SMILES | CC(=O)N(CCC(=O)Nc1ccccc1C(C)(C)C)CC1CCCO1 |
| InChI | InChI=1S/C20H30N2O3/c1-15(23)22(14-16-8-7-13-25-16)12-11-19(24)21-18-10-6-5-9-17(18)20(2,3)4/h5-6,9-10,16H,7-8,11-14H2,1-4H3,(H,21,24) |
| InChIKey | HCAYJMVYBDQORB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |