C17H30O4 — CID 11312571
1-[(4S,6R)-6-[(2R,6S)-2-hydroxy-6-methyloct-7-en-2-yl]-2,2-dimethyl-1,3-dioxan-4-yl]ethanone (PubChem CID 11312571) has the molecular formula C17H30O4 and a molecular weight of 298.42 g/mol. Its IUPAC name is 1-[(4S,6R)-6-[(2R,6S)-2-hydroxy-6-methyloct-7-en-2-yl]-2,2-dimethyl-1,3-dioxan-4-yl]ethanone.
| Compound Name | 1-[(4S,6R)-6-[(2R,6S)-2-hydroxy-6-methyloct-7-en-2-yl]-2,2-dimethyl-1,3-dioxan-4-yl]ethanone |
|---|---|
| PubChem CID | 11312571 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | 1-[(4S,6R)-6-[(2R,6S)-2-hydroxy-6-methyloct-7-en-2-yl]-2,2-dimethyl-1,3-dioxan-4-yl]ethanone |
| SMILES | C=C[C@@H](C)CCC[C@@](C)(O)[C@H]1C[C@@H](C(C)=O)OC(C)(C)O1 |
| InChI | InChI=1S/C17H30O4/c1-7-12(2)9-8-10-17(6,19)15-11-14(13(3)18)20-16(4,5)21-15/h7,12,14-15,19H,1,8-11H2,2-6H3/t12-,14+,15-,17-/m1/s1 |
| InChIKey | RACBZNVYDFPJOO-DUFGSWQCSA-N |
| XLogP | 3.23 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|