C19H34O4 — CID 10969455
(2R)-1-[(4R,5R)-5-[(2S,3R,4S)-3-hydroxy-4-methylhex-5-en-2-yl]-2,2,4-trimethyl-1,3-dioxolan-4-yl]-2-methylpentan-3-one (PubChem CID 10969455) has the molecular formula C19H34O4 and a molecular weight of 326.48 g/mol. Its IUPAC name is (2R)-1-[(4R,5R)-5-[(2S,3R,4S)-3-hydroxy-4-methylhex-5-en-2-yl]-2,2,4-trimethyl-1,3-dioxolan-4-yl]-2-methylpentan-3-one.
| Compound Name | (2R)-1-[(4R,5R)-5-[(2S,3R,4S)-3-hydroxy-4-methylhex-5-en-2-yl]-2,2,4-trimethyl-1,3-dioxolan-4-yl]-2-methylpentan-3-one |
|---|---|
| PubChem CID | 10969455 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | (2R)-1-[(4R,5R)-5-[(2S,3R,4S)-3-hydroxy-4-methylhex-5-en-2-yl]-2,2,4-trimethyl-1,3-dioxolan-4-yl]-2-methylpentan-3-one |
| SMILES | C=C[C@H](C)[C@@H](O)[C@H](C)[C@H]1OC(C)(C)O[C@]1(C)C[C@@H](C)C(=O)CC |
| InChI | InChI=1S/C19H34O4/c1-9-12(3)16(21)14(5)17-19(8,23-18(6,7)22-17)11-13(4)15(20)10-2/h9,12-14,16-17,21H,1,10-11H2,2-8H3/t12-,13+,14-,16+,17+,19+/m0/s1 |
| InChIKey | WFWDMXJSJIAOTP-RTEVUOIBSA-N |
| XLogP | 3.72 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|