C27H48O6 — CID 11476907
(1S,6S,9R,13R,14S,15S,17R,19S)-15-hydroxy-14-(methoxymethoxy)-6,13,19-trimethyl-11-methylidene-9-propyl-8,20-dioxabicyclo[15.2.1]icosan-7-one (PubChem CID 11476907) has the molecular formula C27H48O6 and a molecular weight of 468.68 g/mol. Its IUPAC name is (1S,6S,9R,13R,14S,15S,17R,19S)-15-hydroxy-14-(methoxymethoxy)-6,13,19-trimethyl-11-methylidene-9-propyl-8,20-dioxabicyclo[15.2.1]icosan-7-one.
| Compound Name | (1S,6S,9R,13R,14S,15S,17R,19S)-15-hydroxy-14-(methoxymethoxy)-6,13,19-trimethyl-11-methylidene-9-propyl-8,20-dioxabicyclo[15.2.1]icosan-7-one |
|---|---|
| PubChem CID | 11476907 |
| Molecular Formula | C27H48O6 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.35 |
| IUPAC Name | (1S,6S,9R,13R,14S,15S,17R,19S)-15-hydroxy-14-(methoxymethoxy)-6,13,19-trimethyl-11-methylidene-9-propyl-8,20-dioxabicyclo[15.2.1]icosan-7-one |
| SMILES | C=C1C[C@@H](CCC)OC(=O)[C@@H](C)CCCC[C@@H]2O[C@H](C[C@@H]2C)C[C@H](O)[C@@H](OCOC)[C@H](C)C1 |
| InChI | InChI=1S/C27H48O6/c1-7-10-22-14-18(2)13-21(5)26(31-17-30-6)24(28)16-23-15-20(4)25(32-23)12-9-8-11-19(3)27(29)33-22/h19-26,28H,2,7-17H2,1,3-6H3/t19-,20-,21+,22+,23+,24-,25-,26-/m0/s1 |
| InChIKey | KPPAVSQOKVDTAD-UYZZHRCQSA-N |
| XLogP | 5.41 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|